C15H28O4 — CID 173346939
(1-ethoxy-3,3,5,5-tetramethylhexan-2-yl) prop-2-eneperoxoate (PubChem CID 173346939) has the molecular formula C15H28O4 and a molecular weight of 272.38 g/mol. Its IUPAC name is (1-ethoxy-3,3,5,5-tetramethylhexan-2-yl) prop-2-eneperoxoate.
| Compound Name | (1-ethoxy-3,3,5,5-tetramethylhexan-2-yl) prop-2-eneperoxoate |
|---|---|
| PubChem CID | 173346939 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | (1-ethoxy-3,3,5,5-tetramethylhexan-2-yl) prop-2-eneperoxoate |
| SMILES | C=CC(=O)OOC(COCC)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C15H28O4/c1-8-13(16)19-18-12(10-17-9-2)15(6,7)11-14(3,4)5/h8,12H,1,9-11H2,2-7H3 |
| InChIKey | KUSRPTOTXJNLKO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|