C15H19BFNO6 — CID 170563965
[2-(4-ethoxy-4-oxobutanoyl)-7-fluoro-6-methoxy-1,3-dihydroisoindol-5-yl]boronic acid (PubChem CID 170563965) has the molecular formula C15H19BFNO6 and a molecular weight of 339.13 g/mol. Its IUPAC name is [2-(4-ethoxy-4-oxobutanoyl)-7-fluoro-6-methoxy-1,3-dihydroisoindol-5-yl]boronic acid.
| Compound Name | [2-(4-ethoxy-4-oxobutanoyl)-7-fluoro-6-methoxy-1,3-dihydroisoindol-5-yl]boronic acid |
|---|---|
| PubChem CID | 170563965 |
| Molecular Formula | C15H19BFNO6 |
| Molecular Weight | 339.13 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | [2-(4-ethoxy-4-oxobutanoyl)-7-fluoro-6-methoxy-1,3-dihydroisoindol-5-yl]boronic acid |
| SMILES | CCOC(=O)CCC(=O)N1Cc2cc(B(O)O)c(OC)c(F)c2C1 |
| InChI | InChI=1S/C15H19BFNO6/c1-3-24-13(20)5-4-12(19)18-7-9-6-11(16(21)22)15(23-2)14(17)10(9)8-18/h6,21-22H,3-5,7-8H2,1-2H3 |
| InChIKey | BVWAEGOYBLWKPN-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.13 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|