C22H18F7N3O6 — CID 170570575
ethyl 2-[[[2-formamido-2-[3-(trifluoromethyl)phenyl]acetyl]amino]-[2-(2,3,5,6-tetrafluorophenoxy)acetyl]amino]acetate (PubChem CID 170570575) has the molecular formula C22H18F7N3O6 and a molecular weight of 553.39 g/mol. Its IUPAC name is ethyl 2-[[[2-formamido-2-[3-(trifluoromethyl)phenyl]acetyl]amino]-[2-(2,3,5,6-tetrafluorophenoxy)acetyl]amino]acetate.
| Compound Name | ethyl 2-[[[2-formamido-2-[3-(trifluoromethyl)phenyl]acetyl]amino]-[2-(2,3,5,6-tetrafluorophenoxy)acetyl]amino]acetate |
|---|---|
| PubChem CID | 170570575 |
| Molecular Formula | C22H18F7N3O6 |
| Molecular Weight | 553.39 g/mol |
| Exact Mass | 553.11 |
| IUPAC Name | ethyl 2-[[[2-formamido-2-[3-(trifluoromethyl)phenyl]acetyl]amino]-[2-(2,3,5,6-tetrafluorophenoxy)acetyl]amino]acetate |
| SMILES | CCOC(=O)CN(NC(=O)C(NC=O)c1cccc(C(F)(F)F)c1)C(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C22H18F7N3O6/c1-2-37-16(35)8-32(15(34)9-38-20-17(25)13(23)7-14(24)18(20)26)31-21(36)19(30-10-33)11-4-3-5-12(6-11)22(27,28)29/h3-7,10,19H,2,8-9H2,1H3,(H,30,33)(H,31,36) |
| InChIKey | DUUGNIJSAXUGCJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|