C16H25N3OS — CID 170574786
ethane;6-ethyl-4-(1,2-thiazol-5-yl)pyridine-2-carboxamide;propane (PubChem CID 170574786) has the molecular formula C16H25N3OS and a molecular weight of 307.46 g/mol. Its IUPAC name is ethane;6-ethyl-4-(1,2-thiazol-5-yl)pyridine-2-carboxamide;propane.
| Compound Name | ethane;6-ethyl-4-(1,2-thiazol-5-yl)pyridine-2-carboxamide;propane |
|---|---|
| PubChem CID | 170574786 |
| Molecular Formula | C16H25N3OS |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | ethane;6-ethyl-4-(1,2-thiazol-5-yl)pyridine-2-carboxamide;propane |
| SMILES | CC.CCC.CCc1cc(-c2ccns2)cc(C(N)=O)n1 |
| InChI | InChI=1S/C11H11N3OS.C3H8.C2H6/c1-2-8-5-7(10-3-4-13-16-10)6-9(14-8)11(12)15;1-3-2;1-2/h3-6H,2H2,1H3,(H2,12,15);3H2,1-2H3;1-2H3 |
| InChIKey | UOBOFCZBVTYKAX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |