C9H6ClN3OS — CID 170350951
6-chloro-4-(1,2-thiazol-5-yl)pyridine-2-carboxamide (PubChem CID 170350951) has the molecular formula C9H6ClN3OS and a molecular weight of 239.69 g/mol. Its IUPAC name is 6-chloro-4-(1,2-thiazol-5-yl)pyridine-2-carboxamide.
| Compound Name | 6-chloro-4-(1,2-thiazol-5-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 170350951 |
| Molecular Formula | C9H6ClN3OS |
| Molecular Weight | 239.69 g/mol |
| Exact Mass | 238.99 |
| IUPAC Name | 6-chloro-4-(1,2-thiazol-5-yl)pyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccns2)cc(Cl)n1 |
| InChI | InChI=1S/C9H6ClN3OS/c10-8-4-5(7-1-2-12-15-7)3-6(13-8)9(11)14/h1-4H,(H2,11,14) |
| InChIKey | VGEWXSIJJWGMAY-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.69 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|