C22H21B4N5O4 — CID 170575117
CID 170575117 (PubChem CID 170575117) has the molecular formula C22H21B4N5O4 and a molecular weight of 462.69 g/mol.
| Compound Name | CID 170575117 |
|---|---|
| PubChem CID | 170575117 |
| Molecular Formula | C22H21B4N5O4 |
| Molecular Weight | 462.69 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | — |
| SMILES | NC(=O)c1nc(-c2cccc(-c3ccon3)c2)c2n1CCCC2.[B]C1([B])C(O)C(=O)N(C)C1([B])[B] |
| InChI | InChI=1S/C17H16N4O2.C5H5B4NO2/c18-16(22)17-19-15(14-6-1-2-8-21(14)17)12-5-3-4-11(10-12)13-7-9-23-20-13;1-10-3(12)2(11)4(6,7)5(10,8)9/h3-5,7,9-10H,1-2,6,8H2,(H2,18,22);2,11H,1H3 |
| InChIKey | RSYVYRHIHKIKTQ-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 127.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.69 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|