C16H15N2NaO4 — CID 166257921
sodium 2-[[3-(1,2-oxazol-3-yl)phenyl]carbamoyl]cyclopentane-1-carboxylate (PubChem CID 166257921) has the molecular formula C16H15N2NaO4 and a molecular weight of 322.30 g/mol. Its IUPAC name is sodium 2-[[3-(1,2-oxazol-3-yl)phenyl]carbamoyl]cyclopentane-1-carboxylate.
| Compound Name | sodium 2-[[3-(1,2-oxazol-3-yl)phenyl]carbamoyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 166257921 |
| Molecular Formula | C16H15N2NaO4 |
| Molecular Weight | 322.30 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | sodium 2-[[3-(1,2-oxazol-3-yl)phenyl]carbamoyl]cyclopentane-1-carboxylate |
| SMILES | O=C([O-])C1CCCC1C(=O)Nc1cccc(-c2ccon2)c1.[Na+] |
| InChI | InChI=1S/C16H16N2O4.Na/c19-15(12-5-2-6-13(12)16(20)21)17-11-4-1-3-10(9-11)14-7-8-22-18-14;/h1,3-4,7-9,12-13H,2,5-6H2,(H,17,19)(H,20,21);/q;+1/p-1 |
| InChIKey | DSMDILXECGFNTL-UHFFFAOYSA-M |
| XLogP | -1.55 |
| TPSA | 95.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.30 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |