C13H10N4O2S — CID 170414131
5-amino-2-[3-(1,2-oxazol-3-yl)phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 170414131) has the molecular formula C13H10N4O2S and a molecular weight of 286.32 g/mol. Its IUPAC name is 5-amino-2-[3-(1,2-oxazol-3-yl)phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 5-amino-2-[3-(1,2-oxazol-3-yl)phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 170414131 |
| Molecular Formula | C13H10N4O2S |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 5-amino-2-[3-(1,2-oxazol-3-yl)phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | NC(=O)c1nc(-c2cccc(-c3ccon3)c2)sc1N |
| InChI | InChI=1S/C13H10N4O2S/c14-11(18)10-12(15)20-13(16-10)8-3-1-2-7(6-8)9-4-5-19-17-9/h1-6H,15H2,(H2,14,18) |
| InChIKey | MXBPPWSDIJNGCX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 108.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |