C10H10N2O3 — CID 175520433
carbamic acid;3-phenyl-1,2-oxazole (PubChem CID 175520433) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is carbamic acid;3-phenyl-1,2-oxazole.
| Compound Name | carbamic acid;3-phenyl-1,2-oxazole |
|---|---|
| PubChem CID | 175520433 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | carbamic acid;3-phenyl-1,2-oxazole |
| SMILES | NC(=O)O.c1ccc(-c2ccon2)cc1 |
| InChI | InChI=1S/C9H7NO.CH3NO2/c1-2-4-8(5-3-1)9-6-7-11-10-9;2-1(3)4/h1-7H;2H2,(H,3,4) |
| InChIKey | PRAXBKSKMDFSRW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |