3-(2,6-dichlorophenyl)-1,2-oxazole;2,2,2-trifluoroacetic acid

C11H6Cl2F3NO3 — CID 174938953

IUPAC3-(2,6-dichlorophenyl)-1,2-oxazole;2,2,2-trifluoroacetic acid
SMILESClc1cccc(Cl)c1-c1ccon1.O=C(O)C(F)(F)F
InChIInChI=1S/C9H5Cl2NO.C2HF3O2/c10-6-2-1-3-7(11)9(6)8-4-5-13-12-8;3-2(4,5)1(6)7/h1-5H;(H,6,7)
InChIKeyVUPKVYPFNILGQN-UHFFFAOYSA-N
MW328.07 g/mol
LogP4.28
Rot. Bonds1

About 3-(2,6-dichlorophenyl)-1,2-oxazole;2,2,2-trifluoroacetic acid

3-(2,6-dichlorophenyl)-1,2-oxazole;2,2,2-trifluoroacetic acid (PubChem CID 174938953) has the molecular formula C11H6Cl2F3NO3 and a molecular weight of 328.07 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-1,2-oxazole;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Name3-(2,6-dichlorophenyl)-1,2-oxazole;2,2,2-trifluoroacetic acid
PubChem CID174938953
Molecular FormulaC11H6Cl2F3NO3
Molecular Weight328.07 g/mol
Exact Mass326.97
IUPAC Name3-(2,6-dichlorophenyl)-1,2-oxazole;2,2,2-trifluoroacetic acid
SMILESClc1cccc(Cl)c1-c1ccon1.O=C(O)C(F)(F)F
InChIInChI=1S/C9H5Cl2NO.C2HF3O2/c10-6-2-1-3-7(11)9(6)8-4-5-13-12-8;3-2(4,5)1(6)7/h1-5H;(H,6,7)
InChIKeyVUPKVYPFNILGQN-UHFFFAOYSA-N
XLogP4.28
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500328.07
LogP ≤ 54.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(2,6-dichlorophenyl)-1,2-oxazole;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,6-dichlorophenyl)-1,2-oxazole;2,2,2-trifluoroacetic acid?
The IUPAC name of 3-(2,6-dichlorophenyl)-1,2-oxazole;2,2,2-trifluoroacetic acid (CID 174938953) is 3-(2,6-dichlorophenyl)-1,2-oxazole;2,2,2-trifluoroacetic acid.
What is the SMILES notation for 3-(2,6-dichlorophenyl)-1,2-oxazole;2,2,2-trifluoroacetic acid?
The canonical SMILES for 3-(2,6-dichlorophenyl)-1,2-oxazole;2,2,2-trifluoroacetic acid is Clc1cccc(Cl)c1-c1ccon1.O=C(O)C(F)(F)F.
What is the InChIKey of 3-(2,6-dichlorophenyl)-1,2-oxazole;2,2,2-trifluoroacetic acid?
The InChIKey is VUPKVYPFNILGQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5Cl2NO.C2HF3O2/c10-6-2-1-3-7(11)9(6)8-4-5-13-12-8;3-2(4,5)1(6)7/h1-5H;(H,6,7).
What are the key properties of 3-(2,6-dichlorophenyl)-1,2-oxazole;2,2,2-trifluoroacetic acid?
3-(2,6-dichlorophenyl)-1,2-oxazole;2,2,2-trifluoroacetic acid has a molecular weight of 328.07 g/mol, XLogP of 4.28, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-dichlorophenyl)-1,2-oxazole;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 174938953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).