About [4-chloro-3-(1,2-oxazol-3-yl)phenyl]-phenylmethanone
[4-chloro-3-(1,2-oxazol-3-yl)phenyl]-phenylmethanone (PubChem CID 175076754) has the molecular formula C16H10ClNO2
and a molecular weight of 283.71 g/mol. Its IUPAC name is [4-chloro-3-(1,2-oxazol-3-yl)phenyl]-phenylmethanone.
Molecular Properties
| Compound Name | [4-chloro-3-(1,2-oxazol-3-yl)phenyl]-phenylmethanone |
| PubChem CID | 175076754 |
| Molecular Formula | C16H10ClNO2 |
| Molecular Weight | 283.71 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | [4-chloro-3-(1,2-oxazol-3-yl)phenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccc(Cl)c(-c2ccon2)c1 |
| InChI | InChI=1S/C16H10ClNO2/c17-14-7-6-12(10-13(14)15-8-9-20-18-15)16(19)11-4-2-1-3-5-11/h1-10H |
| InChIKey | XKNYVQRJJMRUNC-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.71 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-chloro-3-(1,2-oxazol-3-yl)phenyl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-chloro-3-(1,2-oxazol-3-yl)phenyl]-phenylmethanone?
The IUPAC name of [4-chloro-3-(1,2-oxazol-3-yl)phenyl]-phenylmethanone (CID 175076754) is [4-chloro-3-(1,2-oxazol-3-yl)phenyl]-phenylmethanone.
What is the SMILES notation for [4-chloro-3-(1,2-oxazol-3-yl)phenyl]-phenylmethanone?
The canonical SMILES for [4-chloro-3-(1,2-oxazol-3-yl)phenyl]-phenylmethanone is O=C(c1ccccc1)c1ccc(Cl)c(-c2ccon2)c1.
What is the InChIKey of [4-chloro-3-(1,2-oxazol-3-yl)phenyl]-phenylmethanone?
The InChIKey is XKNYVQRJJMRUNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10ClNO2/c17-14-7-6-12(10-13(14)15-8-9-20-18-15)16(19)11-4-2-1-3-5-11/h1-10H.
What are the key properties of [4-chloro-3-(1,2-oxazol-3-yl)phenyl]-phenylmethanone?
[4-chloro-3-(1,2-oxazol-3-yl)phenyl]-phenylmethanone has a molecular weight of 283.71 g/mol, XLogP of 4.23, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-chloro-3-(1,2-oxazol-3-yl)phenyl]-phenylmethanone is sourced from PubChem (CID 175076754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).