C19H15N3OS — CID 174821823
3-phenyl-1,2-oxazole;quinoline-5-carbothioamide (PubChem CID 174821823) has the molecular formula C19H15N3OS and a molecular weight of 333.42 g/mol. Its IUPAC name is 3-phenyl-1,2-oxazole;quinoline-5-carbothioamide.
| Compound Name | 3-phenyl-1,2-oxazole;quinoline-5-carbothioamide |
|---|---|
| PubChem CID | 174821823 |
| Molecular Formula | C19H15N3OS |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 3-phenyl-1,2-oxazole;quinoline-5-carbothioamide |
| SMILES | NC(=S)c1cccc2ncccc12.c1ccc(-c2ccon2)cc1 |
| InChI | InChI=1S/C10H8N2S.C9H7NO/c11-10(13)8-3-1-5-9-7(8)4-2-6-12-9;1-2-4-8(5-3-1)9-6-7-11-10-9/h1-6H,(H2,11,13);1-7H |
| InChIKey | OJKRVQMDDICWLJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|