C10H9N3O3 — CID 174582249
amino-[2-(1,2-oxazol-3-yl)phenyl]carbamic acid (PubChem CID 174582249) has the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. Its IUPAC name is amino-[2-(1,2-oxazol-3-yl)phenyl]carbamic acid.
| Compound Name | amino-[2-(1,2-oxazol-3-yl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 174582249 |
| Molecular Formula | C10H9N3O3 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | amino-[2-(1,2-oxazol-3-yl)phenyl]carbamic acid |
| SMILES | NN(C(=O)O)c1ccccc1-c1ccon1 |
| InChI | InChI=1S/C10H9N3O3/c11-13(10(14)15)9-4-2-1-3-7(9)8-5-6-16-12-8/h1-6H,11H2,(H,14,15) |
| InChIKey | SGZBEEIMGHKBPD-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|