amino-[2-(1,2-oxazol-3-yl)phenyl]carbamic acid

C10H9N3O3 — CID 174582249

IUPACamino-[2-(1,2-oxazol-3-yl)phenyl]carbamic acid
SMILESNN(C(=O)O)c1ccccc1-c1ccon1
InChIInChI=1S/C10H9N3O3/c11-13(10(14)15)9-4-2-1-3-7(9)8-5-6-16-12-8/h1-6H,11H2,(H,14,15)
InChIKeySGZBEEIMGHKBPD-UHFFFAOYSA-N
MW219.20 g/mol
LogP1.70
Rot. Bonds2

About amino-[2-(1,2-oxazol-3-yl)phenyl]carbamic acid

amino-[2-(1,2-oxazol-3-yl)phenyl]carbamic acid (PubChem CID 174582249) has the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. Its IUPAC name is amino-[2-(1,2-oxazol-3-yl)phenyl]carbamic acid.

Molecular Properties

Compound Nameamino-[2-(1,2-oxazol-3-yl)phenyl]carbamic acid
PubChem CID174582249
Molecular FormulaC10H9N3O3
Molecular Weight219.20 g/mol
Exact Mass219.06
IUPAC Nameamino-[2-(1,2-oxazol-3-yl)phenyl]carbamic acid
SMILESNN(C(=O)O)c1ccccc1-c1ccon1
InChIInChI=1S/C10H9N3O3/c11-13(10(14)15)9-4-2-1-3-7(9)8-5-6-16-12-8/h1-6H,11H2,(H,14,15)
InChIKeySGZBEEIMGHKBPD-UHFFFAOYSA-N
XLogP1.70
TPSA92.59 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.20
LogP ≤ 51.70
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze amino-[2-(1,2-oxazol-3-yl)phenyl]carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of amino-[2-(1,2-oxazol-3-yl)phenyl]carbamic acid?
The IUPAC name of amino-[2-(1,2-oxazol-3-yl)phenyl]carbamic acid (CID 174582249) is amino-[2-(1,2-oxazol-3-yl)phenyl]carbamic acid.
What is the SMILES notation for amino-[2-(1,2-oxazol-3-yl)phenyl]carbamic acid?
The canonical SMILES for amino-[2-(1,2-oxazol-3-yl)phenyl]carbamic acid is NN(C(=O)O)c1ccccc1-c1ccon1.
What is the InChIKey of amino-[2-(1,2-oxazol-3-yl)phenyl]carbamic acid?
The InChIKey is SGZBEEIMGHKBPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O3/c11-13(10(14)15)9-4-2-1-3-7(9)8-5-6-16-12-8/h1-6H,11H2,(H,14,15).
What are the key properties of amino-[2-(1,2-oxazol-3-yl)phenyl]carbamic acid?
amino-[2-(1,2-oxazol-3-yl)phenyl]carbamic acid has a molecular weight of 219.20 g/mol, XLogP of 1.70, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for amino-[2-(1,2-oxazol-3-yl)phenyl]carbamic acid is sourced from PubChem (CID 174582249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).