C18H20ClIN5O2P — CID 170577306
cyclohexa-1,5-dien-1-ylmethyl N-[1-(6-chloro-1-iodophosphanylpyrazolo[4,3-c]pyridin-3-yl)pyrrolidin-3-yl]carbamate (PubChem CID 170577306) has the molecular formula C18H20ClIN5O2P and a molecular weight of 531.72 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-ylmethyl N-[1-(6-chloro-1-iodophosphanylpyrazolo[4,3-c]pyridin-3-yl)pyrrolidin-3-yl]carbamate.
| Compound Name | cyclohexa-1,5-dien-1-ylmethyl N-[1-(6-chloro-1-iodophosphanylpyrazolo[4,3-c]pyridin-3-yl)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 170577306 |
| Molecular Formula | C18H20ClIN5O2P |
| Molecular Weight | 531.72 g/mol |
| Exact Mass | 531.01 |
| IUPAC Name | cyclohexa-1,5-dien-1-ylmethyl N-[1-(6-chloro-1-iodophosphanylpyrazolo[4,3-c]pyridin-3-yl)pyrrolidin-3-yl]carbamate |
| SMILES | O=C(NC1CCN(c2nn(PI)c3cc(Cl)ncc23)C1)OCC1=CCCC=C1 |
| InChI | InChI=1S/C18H20ClIN5O2P/c19-16-8-15-14(9-21-16)17(23-25(15)28-20)24-7-6-13(10-24)22-18(26)27-11-12-4-2-1-3-5-12/h2,4-5,8-9,13,28H,1,3,6-7,10-11H2,(H,22,26) |
| InChIKey | PVTSALPLLMRXOI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.72 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|