C11H16LrN2O-2 — CID 170581096
carbanide;lawrencium;N-propan-2-yl-2-(3H-pyridin-3-id-4-yl)acetamide (PubChem CID 170581096) has the molecular formula C11H16LrN2O-2 and a molecular weight of 454.26 g/mol. Its IUPAC name is carbanide;lawrencium;N-propan-2-yl-2-(3H-pyridin-3-id-4-yl)acetamide.
| Compound Name | carbanide;lawrencium;N-propan-2-yl-2-(3H-pyridin-3-id-4-yl)acetamide |
|---|---|
| PubChem CID | 170581096 |
| Molecular Formula | C11H16LrN2O-2 |
| Molecular Weight | 454.26 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | carbanide;lawrencium;N-propan-2-yl-2-(3H-pyridin-3-id-4-yl)acetamide |
| SMILES | CC(C)NC(=O)Cc1[c-]cncc1.[CH3-].[Lr] |
| InChI | InChI=1S/C10H13N2O.CH3.Lr/c1-8(2)12-10(13)7-9-3-5-11-6-4-9;;/h3,5-6,8H,7H2,1-2H3,(H,12,13);1H3;/q2*-1; |
| InChIKey | DGCWQDWIMVUPFW-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|