C13H23N3O — CID 144920923
4-amino-N-[(Z)-3-[(Z)-3-iminoprop-1-enyl]hex-3-enyl]butanamide (PubChem CID 144920923) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 4-amino-N-[(Z)-3-[(Z)-3-iminoprop-1-enyl]hex-3-enyl]butanamide.
| Compound Name | 4-amino-N-[(Z)-3-[(Z)-3-iminoprop-1-enyl]hex-3-enyl]butanamide |
|---|---|
| PubChem CID | 144920923 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 4-amino-N-[(Z)-3-[(Z)-3-iminoprop-1-enyl]hex-3-enyl]butanamide |
| SMILES | [H]/N=C\C=C/C(=C\CC)CCNC(=O)CCCN |
| InChI | InChI=1S/C13H23N3O/c1-2-5-12(6-3-9-14)8-11-16-13(17)7-4-10-15/h3,5-6,9,14H,2,4,7-8,10-11,15H2,1H3,(H,16,17)/b6-3-,12-5+,14-9- |
| InChIKey | HNGQMYBIWVFUOM-FHLYZCCDSA-N |
| XLogP | 1.77 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|