C20H32N2O — CID 123341356
(3E,6Z,8Z)-2-methanimidoyl-4,7-dimethyl-5-methylidene-N-pentylundeca-3,6,8-trienamide (PubChem CID 123341356) has the molecular formula C20H32N2O and a molecular weight of 316.49 g/mol. Its IUPAC name is (3E,6Z,8Z)-2-methanimidoyl-4,7-dimethyl-5-methylidene-N-pentylundeca-3,6,8-trienamide.
| Compound Name | (3E,6Z,8Z)-2-methanimidoyl-4,7-dimethyl-5-methylidene-N-pentylundeca-3,6,8-trienamide |
|---|---|
| PubChem CID | 123341356 |
| Molecular Formula | C20H32N2O |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.25 |
| IUPAC Name | (3E,6Z,8Z)-2-methanimidoyl-4,7-dimethyl-5-methylidene-N-pentylundeca-3,6,8-trienamide |
| SMILES | [H]/N=C/C(/C=C(\C)C(=C)/C=C(C)\C=C/CC)C(=O)NCCCCC |
| InChI | InChI=1S/C20H32N2O/c1-6-8-10-12-22-20(23)19(15-21)14-18(5)17(4)13-16(3)11-9-7-2/h9,11,13-15,19,21H,4,6-8,10,12H2,1-3,5H3,(H,22,23)/b11-9-,16-13-,18-14+,21-15+ |
| InChIKey | LEXPYHGQXSQUHB-HCYARPNTSA-N |
| XLogP | 4.97 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|