C14H16N2O — CID 171559180
(2E,3Z)-N-ethyl-2,3-bis(prop-2-enylidene)pyridine-4-carboxamide (PubChem CID 171559180) has the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. Its IUPAC name is (2E,3Z)-N-ethyl-2,3-bis(prop-2-enylidene)pyridine-4-carboxamide.
| Compound Name | (2E,3Z)-N-ethyl-2,3-bis(prop-2-enylidene)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 171559180 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | (2E,3Z)-N-ethyl-2,3-bis(prop-2-enylidene)pyridine-4-carboxamide |
| SMILES | C=C/C=c1/c(C(=O)NCC)ccn/c1=C/C=C |
| InChI | InChI=1S/C14H16N2O/c1-4-7-11-12(14(17)15-6-3)9-10-16-13(11)8-5-2/h4-5,7-10H,1-2,6H2,3H3,(H,15,17)/b11-7-,13-8+ |
| InChIKey | CNZNGWZRFMPMRA-JKNYEHFOSA-N |
| XLogP | 0.76 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |