C14H16BN3S — CID 170581885
4-(3,5-dimethylthieno[2,3-c]pyridazin-6-yl)borinane-1-carbonitrile (PubChem CID 170581885) has the molecular formula C14H16BN3S and a molecular weight of 269.18 g/mol. Its IUPAC name is 4-(3,5-dimethylthieno[2,3-c]pyridazin-6-yl)borinane-1-carbonitrile.
| Compound Name | 4-(3,5-dimethylthieno[2,3-c]pyridazin-6-yl)borinane-1-carbonitrile |
|---|---|
| PubChem CID | 170581885 |
| Molecular Formula | C14H16BN3S |
| Molecular Weight | 269.18 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 4-(3,5-dimethylthieno[2,3-c]pyridazin-6-yl)borinane-1-carbonitrile |
| SMILES | Cc1cc2c(C)c(C3CCB(C#N)CC3)sc2nn1 |
| InChI | InChI=1S/C14H16BN3S/c1-9-7-12-10(2)13(19-14(12)18-17-9)11-3-5-15(8-16)6-4-11/h7,11H,3-6H2,1-2H3 |
| InChIKey | LFUDMNQFZMRBBT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.18 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|