C13H13BClN3S — CID 166128175
4-(3-chloro-5-methylthieno[2,3-c]pyridazin-6-yl)borinane-1-carbonitrile (PubChem CID 166128175) has the molecular formula C13H13BClN3S and a molecular weight of 289.60 g/mol. Its IUPAC name is 4-(3-chloro-5-methylthieno[2,3-c]pyridazin-6-yl)borinane-1-carbonitrile.
| Compound Name | 4-(3-chloro-5-methylthieno[2,3-c]pyridazin-6-yl)borinane-1-carbonitrile |
|---|---|
| PubChem CID | 166128175 |
| Molecular Formula | C13H13BClN3S |
| Molecular Weight | 289.60 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 4-(3-chloro-5-methylthieno[2,3-c]pyridazin-6-yl)borinane-1-carbonitrile |
| SMILES | Cc1c(C2CCB(C#N)CC2)sc2nnc(Cl)cc12 |
| InChI | InChI=1S/C13H13BClN3S/c1-8-10-6-11(15)17-18-13(10)19-12(8)9-2-4-14(7-16)5-3-9/h6,9H,2-5H2,1H3 |
| InChIKey | PJPKSFQQPOPVCA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.60 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|