C10H10ClN3S — CID 166128201
12-chloro-4-methyl-8-thia-4,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene (PubChem CID 166128201) has the molecular formula C10H10ClN3S and a molecular weight of 239.73 g/mol. Its IUPAC name is 12-chloro-4-methyl-8-thia-4,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene.
| Compound Name | 12-chloro-4-methyl-8-thia-4,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene |
|---|---|
| PubChem CID | 166128201 |
| Molecular Formula | C10H10ClN3S |
| Molecular Weight | 239.73 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 12-chloro-4-methyl-8-thia-4,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene |
| SMILES | CN1CCc2sc3nnc(Cl)cc3c2C1 |
| InChI | InChI=1S/C10H10ClN3S/c1-14-3-2-8-7(5-14)6-4-9(11)12-13-10(6)15-8/h4H,2-3,5H2,1H3 |
| InChIKey | FDWJPSHYDAZMFB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.73 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |