C10H7BClN3S — CID 166128115
3-(3-chlorothieno[2,3-c]pyridazin-6-yl)boretane-1-carbonitrile (PubChem CID 166128115) has the molecular formula C10H7BClN3S and a molecular weight of 247.52 g/mol. Its IUPAC name is 3-(3-chlorothieno[2,3-c]pyridazin-6-yl)boretane-1-carbonitrile.
| Compound Name | 3-(3-chlorothieno[2,3-c]pyridazin-6-yl)boretane-1-carbonitrile |
|---|---|
| PubChem CID | 166128115 |
| Molecular Formula | C10H7BClN3S |
| Molecular Weight | 247.52 g/mol |
| Exact Mass | 247.01 |
| IUPAC Name | 3-(3-chlorothieno[2,3-c]pyridazin-6-yl)boretane-1-carbonitrile |
| SMILES | N#CB1CC(c2cc3cc(Cl)nnc3s2)C1 |
| InChI | InChI=1S/C10H7BClN3S/c12-9-2-6-1-8(16-10(6)15-14-9)7-3-11(4-7)5-13/h1-2,7H,3-4H2 |
| InChIKey | IWBNYQIOBXZMAX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.52 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|