C9H10ClN3S — CID 123586516
3-chloro-6-propan-2-ylthieno[2,3-c]pyridazin-5-amine (PubChem CID 123586516) has the molecular formula C9H10ClN3S and a molecular weight of 227.72 g/mol. Its IUPAC name is 3-chloro-6-propan-2-ylthieno[2,3-c]pyridazin-5-amine.
| Compound Name | 3-chloro-6-propan-2-ylthieno[2,3-c]pyridazin-5-amine |
|---|---|
| PubChem CID | 123586516 |
| Molecular Formula | C9H10ClN3S |
| Molecular Weight | 227.72 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 3-chloro-6-propan-2-ylthieno[2,3-c]pyridazin-5-amine |
| SMILES | CC(C)c1sc2nnc(Cl)cc2c1N |
| InChI | InChI=1S/C9H10ClN3S/c1-4(2)8-7(11)5-3-6(10)12-13-9(5)14-8/h3-4H,11H2,1-2H3 |
| InChIKey | KDRNTOYPTFLQPB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.72 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |