C20H22BN3OS — CID 170581697
4-[3-[(3Z,5E)-5-hydroxyhepta-1,3,5-trien-4-yl]-5-methylthieno[2,3-c]pyridazin-6-yl]borinane-1-carbonitrile (PubChem CID 170581697) has the molecular formula C20H22BN3OS and a molecular weight of 363.30 g/mol. Its IUPAC name is 4-[3-[(3Z,5E)-5-hydroxyhepta-1,3,5-trien-4-yl]-5-methylthieno[2,3-c]pyridazin-6-yl]borinane-1-carbonitrile.
| Compound Name | 4-[3-[(3Z,5E)-5-hydroxyhepta-1,3,5-trien-4-yl]-5-methylthieno[2,3-c]pyridazin-6-yl]borinane-1-carbonitrile |
|---|---|
| PubChem CID | 170581697 |
| Molecular Formula | C20H22BN3OS |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 4-[3-[(3Z,5E)-5-hydroxyhepta-1,3,5-trien-4-yl]-5-methylthieno[2,3-c]pyridazin-6-yl]borinane-1-carbonitrile |
| SMILES | C=C/C=C(C(\O)=C/C)/c1cc2c(C)c(C3CCB(C#N)CC3)sc2nn1 |
| InChI | InChI=1S/C20H22BN3OS/c1-4-6-15(18(25)5-2)17-11-16-13(3)19(26-20(16)24-23-17)14-7-9-21(12-22)10-8-14/h4-6,11,14,25H,1,7-10H2,2-3H3/b15-6-,18-5+ |
| InChIKey | WNKUJBWBYNSYHP-IVAJKEIBSA-N |
| XLogP | 5.47 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|