C17H19N3OS — CID 170581979
(3Z)-3-(6-piperidin-4-ylthieno[2,3-c]pyridazin-3-yl)hexa-1,3,5-trien-2-ol (PubChem CID 170581979) has the molecular formula C17H19N3OS and a molecular weight of 313.43 g/mol. Its IUPAC name is (3Z)-3-(6-piperidin-4-ylthieno[2,3-c]pyridazin-3-yl)hexa-1,3,5-trien-2-ol.
| Compound Name | (3Z)-3-(6-piperidin-4-ylthieno[2,3-c]pyridazin-3-yl)hexa-1,3,5-trien-2-ol |
|---|---|
| PubChem CID | 170581979 |
| Molecular Formula | C17H19N3OS |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | (3Z)-3-(6-piperidin-4-ylthieno[2,3-c]pyridazin-3-yl)hexa-1,3,5-trien-2-ol |
| SMILES | C=C/C=C(\C(=C)O)c1cc2cc(C3CCNCC3)sc2nn1 |
| InChI | InChI=1S/C17H19N3OS/c1-3-4-14(11(2)21)15-9-13-10-16(22-17(13)20-19-15)12-5-7-18-8-6-12/h3-4,9-10,12,18,21H,1-2,5-8H2/b14-4+ |
| InChIKey | ISOMSOLORULNJU-LNKIKWGQSA-N |
| XLogP | 3.80 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|