C16H14BN3OS — CID 170581689
3-[3-[(3Z)-2-hydroxyhexa-1,3,5-trien-3-yl]thieno[2,3-c]pyridazin-6-yl]boretane-1-carbonitrile (PubChem CID 170581689) has the molecular formula C16H14BN3OS and a molecular weight of 307.19 g/mol. Its IUPAC name is 3-[3-[(3Z)-2-hydroxyhexa-1,3,5-trien-3-yl]thieno[2,3-c]pyridazin-6-yl]boretane-1-carbonitrile.
| Compound Name | 3-[3-[(3Z)-2-hydroxyhexa-1,3,5-trien-3-yl]thieno[2,3-c]pyridazin-6-yl]boretane-1-carbonitrile |
|---|---|
| PubChem CID | 170581689 |
| Molecular Formula | C16H14BN3OS |
| Molecular Weight | 307.19 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 3-[3-[(3Z)-2-hydroxyhexa-1,3,5-trien-3-yl]thieno[2,3-c]pyridazin-6-yl]boretane-1-carbonitrile |
| SMILES | C=C/C=C(\C(=C)O)c1cc2cc(C3CB(C#N)C3)sc2nn1 |
| InChI | InChI=1S/C16H14BN3OS/c1-3-4-13(10(2)21)14-5-11-6-15(22-16(11)20-19-14)12-7-17(8-12)9-18/h3-6,12,21H,1-2,7-8H2/b13-4+ |
| InChIKey | NMAORWSQCSZBAR-YIXHJXPBSA-N |
| XLogP | 3.99 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.19 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|