C14H31N3O — CID 170584460
N,2-dimethylpropan-1-amine;ethane;3-morpholin-4-ylprop-1-yn-1-amine (PubChem CID 170584460) has the molecular formula C14H31N3O and a molecular weight of 257.42 g/mol. Its IUPAC name is N,2-dimethylpropan-1-amine;ethane;3-morpholin-4-ylprop-1-yn-1-amine.
| Compound Name | N,2-dimethylpropan-1-amine;ethane;3-morpholin-4-ylprop-1-yn-1-amine |
|---|---|
| PubChem CID | 170584460 |
| Molecular Formula | C14H31N3O |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.25 |
| IUPAC Name | N,2-dimethylpropan-1-amine;ethane;3-morpholin-4-ylprop-1-yn-1-amine |
| SMILES | CC.CNCC(C)C.NC#CCN1CCOCC1 |
| InChI | InChI=1S/C7H12N2O.C5H13N.C2H6/c8-2-1-3-9-4-6-10-7-5-9;1-5(2)4-6-3;1-2/h3-8H2;5-6H,4H2,1-3H3;1-2H3 |
| InChIKey | WTTOZWZDAPAMAD-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|