C20H39N3O — CID 143536413
ethane;N-ethyl-N,3-dimethylhex-4-yn-1-amine;N-methyl-3-morpholin-4-ylprop-1-yn-1-amine (PubChem CID 143536413) has the molecular formula C20H39N3O and a molecular weight of 337.55 g/mol. Its IUPAC name is ethane;N-ethyl-N,3-dimethylhex-4-yn-1-amine;N-methyl-3-morpholin-4-ylprop-1-yn-1-amine.
| Compound Name | ethane;N-ethyl-N,3-dimethylhex-4-yn-1-amine;N-methyl-3-morpholin-4-ylprop-1-yn-1-amine |
|---|---|
| PubChem CID | 143536413 |
| Molecular Formula | C20H39N3O |
| Molecular Weight | 337.55 g/mol |
| Exact Mass | 337.31 |
| IUPAC Name | ethane;N-ethyl-N,3-dimethylhex-4-yn-1-amine;N-methyl-3-morpholin-4-ylprop-1-yn-1-amine |
| SMILES | CC.CC#CC(C)CCN(C)CC.CNC#CCN1CCOCC1 |
| InChI | InChI=1S/C10H19N.C8H14N2O.C2H6/c1-5-7-10(3)8-9-11(4)6-2;1-9-3-2-4-10-5-7-11-8-6-10;1-2/h10H,6,8-9H2,1-4H3;9H,4-8H2,1H3;1-2H3 |
| InChIKey | FUKQYIVVBUNYTM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.55 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|