C17H16N6O5 — CID 170585253
1-[9-[(2R)-5-(hydroxymethyl)-4-oxooxolan-2-yl]-8-oxo-7H-purin-6-yl]-3-phenylurea (PubChem CID 170585253) has the molecular formula C17H16N6O5 and a molecular weight of 384.35 g/mol. Its IUPAC name is 1-[9-[(2R)-5-(hydroxymethyl)-4-oxooxolan-2-yl]-8-oxo-7H-purin-6-yl]-3-phenylurea.
| Compound Name | 1-[9-[(2R)-5-(hydroxymethyl)-4-oxooxolan-2-yl]-8-oxo-7H-purin-6-yl]-3-phenylurea |
|---|---|
| PubChem CID | 170585253 |
| Molecular Formula | C17H16N6O5 |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 1-[9-[(2R)-5-(hydroxymethyl)-4-oxooxolan-2-yl]-8-oxo-7H-purin-6-yl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1ncnc2c1[nH]c(=O)n2[C@H]1CC(=O)C(CO)O1 |
| InChI | InChI=1S/C17H16N6O5/c24-7-11-10(25)6-12(28-11)23-15-13(21-17(23)27)14(18-8-19-15)22-16(26)20-9-4-2-1-3-5-9/h1-5,8,11-12,24H,6-7H2,(H,21,27)(H2,18,19,20,22,26)/t11?,12-/m1/s1 |
| InChIKey | AVFGKVZKSVLJFL-PIJUOVFKSA-N |
| XLogP | 0.61 |
| TPSA | 151.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |