C17H20BN7O3S — CID 143041547
N-methylsulfanyl-[5-[6-(phenylcarbamoylamino)purin-9-yl]oxolan-2-yl]boronamidic acid (PubChem CID 143041547) has the molecular formula C17H20BN7O3S and a molecular weight of 413.27 g/mol. Its IUPAC name is N-methylsulfanyl-[5-[6-(phenylcarbamoylamino)purin-9-yl]oxolan-2-yl]boronamidic acid.
| Compound Name | N-methylsulfanyl-[5-[6-(phenylcarbamoylamino)purin-9-yl]oxolan-2-yl]boronamidic acid |
|---|---|
| PubChem CID | 143041547 |
| Molecular Formula | C17H20BN7O3S |
| Molecular Weight | 413.27 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | N-methylsulfanyl-[5-[6-(phenylcarbamoylamino)purin-9-yl]oxolan-2-yl]boronamidic acid |
| SMILES | CSNB(O)C1CCC(n2cnc3c(NC(=O)Nc4ccccc4)ncnc32)O1 |
| InChI | InChI=1S/C17H20BN7O3S/c1-29-24-18(27)12-7-8-13(28-12)25-10-21-14-15(19-9-20-16(14)25)23-17(26)22-11-5-3-2-4-6-11/h2-6,9-10,12-13,24,27H,7-8H2,1H3,(H2,19,20,22,23,26) |
| InChIKey | FNJDYMOWXZVXLC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 126.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|