C19H21N5O5 — CID 174181348
N-[9-[(2R,5R)-5-ethyl-4-hydroxyoxolan-2-yl]-8-oxo-7H-purin-6-yl]-2-phenoxyacetamide (PubChem CID 174181348) has the molecular formula C19H21N5O5 and a molecular weight of 399.41 g/mol. Its IUPAC name is N-[9-[(2R,5R)-5-ethyl-4-hydroxyoxolan-2-yl]-8-oxo-7H-purin-6-yl]-2-phenoxyacetamide.
| Compound Name | N-[9-[(2R,5R)-5-ethyl-4-hydroxyoxolan-2-yl]-8-oxo-7H-purin-6-yl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 174181348 |
| Molecular Formula | C19H21N5O5 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | N-[9-[(2R,5R)-5-ethyl-4-hydroxyoxolan-2-yl]-8-oxo-7H-purin-6-yl]-2-phenoxyacetamide |
| SMILES | CC[C@H]1O[C@@H](n2c(=O)[nH]c3c(NC(=O)COc4ccccc4)ncnc32)CC1O |
| InChI | InChI=1S/C19H21N5O5/c1-2-13-12(25)8-15(29-13)24-18-16(23-19(24)27)17(20-10-21-18)22-14(26)9-28-11-6-4-3-5-7-11/h3-7,10,12-13,15,25H,2,8-9H2,1H3,(H,23,27)(H,20,21,22,26)/t12?,13-,15-/m1/s1 |
| InChIKey | UXJBSOJMIYRSBG-JYRZLJSNSA-N |
| XLogP | 1.20 |
| TPSA | 131.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |