C17H24F3NO — CID 170589044
1-[[3-methoxy-4-propan-2-yl-5-(trifluoromethyl)phenyl]methyl]piperidine (PubChem CID 170589044) has the molecular formula C17H24F3NO and a molecular weight of 315.38 g/mol. Its IUPAC name is 1-[[3-methoxy-4-propan-2-yl-5-(trifluoromethyl)phenyl]methyl]piperidine.
| Compound Name | 1-[[3-methoxy-4-propan-2-yl-5-(trifluoromethyl)phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 170589044 |
| Molecular Formula | C17H24F3NO |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 1-[[3-methoxy-4-propan-2-yl-5-(trifluoromethyl)phenyl]methyl]piperidine |
| SMILES | COc1cc(CN2CCCCC2)cc(C(F)(F)F)c1C(C)C |
| InChI | InChI=1S/C17H24F3NO/c1-12(2)16-14(17(18,19)20)9-13(10-15(16)22-3)11-21-7-5-4-6-8-21/h9-10,12H,4-8,11H2,1-3H3 |
| InChIKey | DHGCPXYFMHTXMV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |