C20H20N4O4 — CID 170590268
N-[(2,4-dimethoxyphenyl)methyl]-1-(3-hydroxyprop-1-ynyl)-6-methylimidazo[1,5-a]pyrazine-3-carboxamide (PubChem CID 170590268) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-1-(3-hydroxyprop-1-ynyl)-6-methylimidazo[1,5-a]pyrazine-3-carboxamide.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-1-(3-hydroxyprop-1-ynyl)-6-methylimidazo[1,5-a]pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 170590268 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-1-(3-hydroxyprop-1-ynyl)-6-methylimidazo[1,5-a]pyrazine-3-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2nc(C#CCO)c3cnc(C)cn23)c(OC)c1 |
| InChI | InChI=1S/C20H20N4O4/c1-13-12-24-17(11-21-13)16(5-4-8-25)23-19(24)20(26)22-10-14-6-7-15(27-2)9-18(14)28-3/h6-7,9,11-12,25H,8,10H2,1-3H3,(H,22,26) |
| InChIKey | FKPALKMALUSTKZ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|