C23H36 — CID 170590689
(8Z)-2-methyl-7-methylidene-5,8,9-tris(prop-1-en-2-yl)dodeca-1,8-diene (PubChem CID 170590689) has the molecular formula C23H36 and a molecular weight of 312.54 g/mol. Its IUPAC name is (8Z)-2-methyl-7-methylidene-5,8,9-tris(prop-1-en-2-yl)dodeca-1,8-diene.
| Compound Name | (8Z)-2-methyl-7-methylidene-5,8,9-tris(prop-1-en-2-yl)dodeca-1,8-diene |
|---|---|
| PubChem CID | 170590689 |
| Molecular Formula | C23H36 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | (8Z)-2-methyl-7-methylidene-5,8,9-tris(prop-1-en-2-yl)dodeca-1,8-diene |
| SMILES | C=C(C)CCC(CC(=C)/C(C(=C)C)=C(/CCC)C(=C)C)C(=C)C |
| InChI | InChI=1S/C23H36/c1-11-12-22(18(6)7)23(19(8)9)20(10)15-21(17(4)5)14-13-16(2)3/h21H,2,4,6,8,10-15H2,1,3,5,7,9H3/b23-22- |
| InChIKey | NWYXBUDQAFEEIX-FCQUAONHSA-N |
| XLogP | 7.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|