About ethane;(E)-3-methanimidoylpent-3-ene-2,2-diol
ethane;(E)-3-methanimidoylpent-3-ene-2,2-diol (PubChem CID 170592586) has the molecular formula C10H23NO2
and a molecular weight of 189.30 g/mol. Its IUPAC name is ethane;(E)-3-methanimidoylpent-3-ene-2,2-diol.
Molecular Properties
| Compound Name | ethane;(E)-3-methanimidoylpent-3-ene-2,2-diol |
| PubChem CID | 170592586 |
| Molecular Formula | C10H23NO2 |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.17 |
| IUPAC Name | ethane;(E)-3-methanimidoylpent-3-ene-2,2-diol |
| SMILES | CC.CC.[H]/N=C/C(=C\C)C(C)(O)O |
| InChI | InChI=1S/C6H11NO2.2C2H6/c1-3-5(4-7)6(2,8)9;2*1-2/h3-4,7-9H,1-2H3;2*1-2H3/b5-3+,7-4+;; |
| InChIKey | UWUHNCQLRJUQBI-BKBQIBNLSA-N |
| XLogP | 2.34 |
| TPSA | 64.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;(E)-3-methanimidoylpent-3-ene-2,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(E)-3-methanimidoylpent-3-ene-2,2-diol?
The IUPAC name of ethane;(E)-3-methanimidoylpent-3-ene-2,2-diol (CID 170592586) is ethane;(E)-3-methanimidoylpent-3-ene-2,2-diol.
What is the SMILES notation for ethane;(E)-3-methanimidoylpent-3-ene-2,2-diol?
The canonical SMILES for ethane;(E)-3-methanimidoylpent-3-ene-2,2-diol is CC.CC.[H]/N=C/C(=C\C)C(C)(O)O.
What is the InChIKey of ethane;(E)-3-methanimidoylpent-3-ene-2,2-diol?
The InChIKey is UWUHNCQLRJUQBI-BKBQIBNLSA-N. The full InChI is InChI=1S/C6H11NO2.2C2H6/c1-3-5(4-7)6(2,8)9;2*1-2/h3-4,7-9H,1-2H3;2*1-2H3/b5-3+,7-4+;;.
What are the key properties of ethane;(E)-3-methanimidoylpent-3-ene-2,2-diol?
ethane;(E)-3-methanimidoylpent-3-ene-2,2-diol has a molecular weight of 189.30 g/mol, XLogP of 2.34, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(E)-3-methanimidoylpent-3-ene-2,2-diol is sourced from PubChem (CID 170592586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).