C12H21NO — CID 167447308
butane;(E)-1-cyclopropylidene-2-methanimidoylbut-2-en-1-ol (PubChem CID 167447308) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is butane;(E)-1-cyclopropylidene-2-methanimidoylbut-2-en-1-ol.
| Compound Name | butane;(E)-1-cyclopropylidene-2-methanimidoylbut-2-en-1-ol |
|---|---|
| PubChem CID | 167447308 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | butane;(E)-1-cyclopropylidene-2-methanimidoylbut-2-en-1-ol |
| SMILES | CCCC.[H]/N=C/C(=C\C)C(O)=C1CC1 |
| InChI | InChI=1S/C8H11NO.C4H10/c1-2-6(5-9)8(10)7-3-4-7;1-3-4-2/h2,5,9-10H,3-4H2,1H3;3-4H2,1-2H3/b6-2+,9-5+; |
| InChIKey | DPOTXURISYSSEO-VKZYDJRRSA-N |
| XLogP | 3.99 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|