C15H27NO — CID 144863616
ethane;(2E,4Z,6Z)-5-ethenyl-4-methanimidoylocta-2,4,6-trien-2-ol (PubChem CID 144863616) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is ethane;(2E,4Z,6Z)-5-ethenyl-4-methanimidoylocta-2,4,6-trien-2-ol.
| Compound Name | ethane;(2E,4Z,6Z)-5-ethenyl-4-methanimidoylocta-2,4,6-trien-2-ol |
|---|---|
| PubChem CID | 144863616 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | ethane;(2E,4Z,6Z)-5-ethenyl-4-methanimidoylocta-2,4,6-trien-2-ol |
| SMILES | CC.CC.[H]/N=C/C(/C=C(\C)O)=C(C=C)\C=C/C |
| InChI | InChI=1S/C11H15NO.2C2H6/c1-4-6-10(5-2)11(8-12)7-9(3)13;2*1-2/h4-8,12-13H,2H2,1,3H3;2*1-2H3/b6-4-,9-7+,11-10-,12-8+;; |
| InChIKey | BVLFCPXOEQNDSD-AMQFAQTISA-N |
| XLogP | 5.21 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|