About (Z)-4-methylidenehex-2-en-1-imine;prop-1-en-1-ol
(Z)-4-methylidenehex-2-en-1-imine;prop-1-en-1-ol (PubChem CID 143048025) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is (Z)-4-methylidenehex-2-en-1-imine;prop-1-en-1-ol.
Molecular Properties
| Compound Name | (Z)-4-methylidenehex-2-en-1-imine;prop-1-en-1-ol |
| PubChem CID | 143048025 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (Z)-4-methylidenehex-2-en-1-imine;prop-1-en-1-ol |
| SMILES | CC=CO.[H]/N=C/C=C\C(=C)CC |
| InChI | InChI=1S/C7H11N.C3H6O/c1-3-7(2)5-4-6-8;1-2-3-4/h4-6,8H,2-3H2,1H3;2-4H,1H3/b5-4-,8-6+; |
| InChIKey | IAQHMVAOWGPPCG-NLAQHMENSA-N |
| XLogP | 3.24 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-methylidenehex-2-en-1-imine;prop-1-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-methylidenehex-2-en-1-imine;prop-1-en-1-ol?
The IUPAC name of (Z)-4-methylidenehex-2-en-1-imine;prop-1-en-1-ol (CID 143048025) is (Z)-4-methylidenehex-2-en-1-imine;prop-1-en-1-ol.
What is the SMILES notation for (Z)-4-methylidenehex-2-en-1-imine;prop-1-en-1-ol?
The canonical SMILES for (Z)-4-methylidenehex-2-en-1-imine;prop-1-en-1-ol is CC=CO.[H]/N=C/C=C\C(=C)CC.
What is the InChIKey of (Z)-4-methylidenehex-2-en-1-imine;prop-1-en-1-ol?
The InChIKey is IAQHMVAOWGPPCG-NLAQHMENSA-N. The full InChI is InChI=1S/C7H11N.C3H6O/c1-3-7(2)5-4-6-8;1-2-3-4/h4-6,8H,2-3H2,1H3;2-4H,1H3/b5-4-,8-6+;.
What are the key properties of (Z)-4-methylidenehex-2-en-1-imine;prop-1-en-1-ol?
(Z)-4-methylidenehex-2-en-1-imine;prop-1-en-1-ol has a molecular weight of 167.25 g/mol, XLogP of 3.24, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-methylidenehex-2-en-1-imine;prop-1-en-1-ol is sourced from PubChem (CID 143048025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).