C17H19N3O3 — CID 170592737
1-aminopropan-2-ol;4-phenoxy-7H-1,7-naphthyridin-8-one (PubChem CID 170592737) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 1-aminopropan-2-ol;4-phenoxy-7H-1,7-naphthyridin-8-one.
| Compound Name | 1-aminopropan-2-ol;4-phenoxy-7H-1,7-naphthyridin-8-one |
|---|---|
| PubChem CID | 170592737 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 1-aminopropan-2-ol;4-phenoxy-7H-1,7-naphthyridin-8-one |
| SMILES | CC(O)CN.O=c1[nH]ccc2c(Oc3ccccc3)ccnc12 |
| InChI | InChI=1S/C14H10N2O2.C3H9NO/c17-14-13-11(6-8-16-14)12(7-9-15-13)18-10-4-2-1-3-5-10;1-3(5)2-4/h1-9H,(H,16,17);3,5H,2,4H2,1H3 |
| InChIKey | MXBYQFLNMXYEFH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |