C12H15F3N2O — CID 170592925
2-(cyclobutylamino)-1-[6-(trifluoromethyl)-2-pyridinyl]ethanol (PubChem CID 170592925) has the molecular formula C12H15F3N2O and a molecular weight of 260.26 g/mol. Its IUPAC name is 2-(cyclobutylamino)-1-[6-(trifluoromethyl)-2-pyridinyl]ethanol.
| Compound Name | 2-(cyclobutylamino)-1-[6-(trifluoromethyl)-2-pyridinyl]ethanol |
|---|---|
| PubChem CID | 170592925 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-(cyclobutylamino)-1-[6-(trifluoromethyl)-2-pyridinyl]ethanol |
| SMILES | OC(CNC1CCC1)c1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H15F3N2O/c13-12(14,15)11-6-2-5-9(17-11)10(18)7-16-8-3-1-4-8/h2,5-6,8,10,16,18H,1,3-4,7H2 |
| InChIKey | GFCKFGVMNUWRIX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |