C19H19BrN2OS — CID 170593212
(6-aminosulfanyl-2-methyl-2,3-dihydroindol-1-yl)-[(2R)-5-bromo-2,3-dihydro-1H-inden-2-yl]methanone (PubChem CID 170593212) has the molecular formula C19H19BrN2OS and a molecular weight of 403.35 g/mol. Its IUPAC name is (6-aminosulfanyl-2-methyl-2,3-dihydroindol-1-yl)-[(2R)-5-bromo-2,3-dihydro-1H-inden-2-yl]methanone.
| Compound Name | (6-aminosulfanyl-2-methyl-2,3-dihydroindol-1-yl)-[(2R)-5-bromo-2,3-dihydro-1H-inden-2-yl]methanone |
|---|---|
| PubChem CID | 170593212 |
| Molecular Formula | C19H19BrN2OS |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | (6-aminosulfanyl-2-methyl-2,3-dihydroindol-1-yl)-[(2R)-5-bromo-2,3-dihydro-1H-inden-2-yl]methanone |
| SMILES | CC1Cc2ccc(SN)cc2N1C(=O)[C@@H]1Cc2ccc(Br)cc2C1 |
| InChI | InChI=1S/C19H19BrN2OS/c1-11-6-13-3-5-17(24-21)10-18(13)22(11)19(23)15-7-12-2-4-16(20)9-14(12)8-15/h2-5,9-11,15H,6-8,21H2,1H3/t11?,15-/m1/s1 |
| InChIKey | DIECBSBQFZEGAU-JOPIAHFSSA-N |
| XLogP | 4.11 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|