C14H6Cl2N2O4 — CID 170594221
1-[2,5-dichloro-4-(2,5-dioxopyrrol-1-yl)phenyl]pyrrole-2,5-dione (PubChem CID 170594221) has the molecular formula C14H6Cl2N2O4 and a molecular weight of 337.12 g/mol. Its IUPAC name is 1-[2,5-dichloro-4-(2,5-dioxopyrrol-1-yl)phenyl]pyrrole-2,5-dione.
| Compound Name | 1-[2,5-dichloro-4-(2,5-dioxopyrrol-1-yl)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 170594221 |
| Molecular Formula | C14H6Cl2N2O4 |
| Molecular Weight | 337.12 g/mol |
| Exact Mass | 335.97 |
| IUPAC Name | 1-[2,5-dichloro-4-(2,5-dioxopyrrol-1-yl)phenyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1c1cc(Cl)c(N2C(=O)C=CC2=O)cc1Cl |
| InChI | InChI=1S/C14H6Cl2N2O4/c15-7-6-10(18-13(21)3-4-14(18)22)8(16)5-9(7)17-11(19)1-2-12(17)20/h1-6H |
| InChIKey | XVLMOSJXCJXIDQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.12 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|