C16H8Cl3NO2 — CID 174836910
1-[2-(2,3,4-trichlorophenyl)phenyl]pyrrole-2,5-dione (PubChem CID 174836910) has the molecular formula C16H8Cl3NO2 and a molecular weight of 352.60 g/mol. Its IUPAC name is 1-[2-(2,3,4-trichlorophenyl)phenyl]pyrrole-2,5-dione.
| Compound Name | 1-[2-(2,3,4-trichlorophenyl)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 174836910 |
| Molecular Formula | C16H8Cl3NO2 |
| Molecular Weight | 352.60 g/mol |
| Exact Mass | 350.96 |
| IUPAC Name | 1-[2-(2,3,4-trichlorophenyl)phenyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1c1ccccc1-c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C16H8Cl3NO2/c17-11-6-5-10(15(18)16(11)19)9-3-1-2-4-12(9)20-13(21)7-8-14(20)22/h1-8H |
| InChIKey | MNZFKSQVLWTCHZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.60 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|