C22H25ClF6N6O — CID 170595338
N'-[7-[(1Z,3Z,5Z)-3-amino-2-chloro-4,5,7,7,7-pentafluorohepta-1,3,5-trienyl]-8-fluoro-2-methoxy-5-propylpyrido[4,3-d]pyrimidin-4-yl]-N,N'-dimethylethane-1,2-diamine (PubChem CID 170595338) has the molecular formula C22H25ClF6N6O and a molecular weight of 538.92 g/mol. Its IUPAC name is N'-[7-[(1Z,3Z,5Z)-3-amino-2-chloro-4,5,7,7,7-pentafluorohepta-1,3,5-trienyl]-8-fluoro-2-methoxy-5-propylpyrido[4,3-d]pyrimidin-4-yl]-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N'-[7-[(1Z,3Z,5Z)-3-amino-2-chloro-4,5,7,7,7-pentafluorohepta-1,3,5-trienyl]-8-fluoro-2-methoxy-5-propylpyrido[4,3-d]pyrimidin-4-yl]-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 170595338 |
| Molecular Formula | C22H25ClF6N6O |
| Molecular Weight | 538.92 g/mol |
| Exact Mass | 538.17 |
| IUPAC Name | N'-[7-[(1Z,3Z,5Z)-3-amino-2-chloro-4,5,7,7,7-pentafluorohepta-1,3,5-trienyl]-8-fluoro-2-methoxy-5-propylpyrido[4,3-d]pyrimidin-4-yl]-N,N'-dimethylethane-1,2-diamine |
| SMILES | CCCc1nc(/C=C(Cl)/C(N)=C(F)\C(F)=C\C(F)(F)F)c(F)c2nc(OC)nc(N(C)CCNC)c12 |
| InChI | InChI=1S/C22H25ClF6N6O/c1-5-6-13-15-19(33-21(36-4)34-20(15)35(3)8-7-31-2)17(26)14(32-13)9-11(23)18(30)16(25)12(24)10-22(27,28)29/h9-10,31H,5-8,30H2,1-4H3/b11-9-,12-10-,18-16- |
| InChIKey | HVPMWENODPAVLV-BKBWPESMSA-N |
| XLogP | 4.92 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.92 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|