C13H24N2 — CID 170596715
(Z)-3-butyl-4-propylhex-3-ene-2,5-diimine (PubChem CID 170596715) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is (Z)-3-butyl-4-propylhex-3-ene-2,5-diimine.
| Compound Name | (Z)-3-butyl-4-propylhex-3-ene-2,5-diimine |
|---|---|
| PubChem CID | 170596715 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | (Z)-3-butyl-4-propylhex-3-ene-2,5-diimine |
| SMILES | [H]/N=C(C)/C(CCC)=C(CCCC)\C(C)=N\[H] |
| InChI | InChI=1S/C13H24N2/c1-5-7-9-13(11(4)15)12(8-6-2)10(3)14/h14-15H,5-9H2,1-4H3/b13-12-,14-10+,15-11+ |
| InChIKey | QRGPLRFOHIKFBQ-SWCQDDKCSA-N |
| XLogP | 4.35 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|