C23H52N4O — CID 170603278
ethane;2-methyl-N-[3-[4-[3-(prop-1-en-2-ylamino)propyl]piperazin-1-yl]propyl]propanamide (PubChem CID 170603278) has the molecular formula C23H52N4O and a molecular weight of 400.70 g/mol. Its IUPAC name is ethane;2-methyl-N-[3-[4-[3-(prop-1-en-2-ylamino)propyl]piperazin-1-yl]propyl]propanamide.
| Compound Name | ethane;2-methyl-N-[3-[4-[3-(prop-1-en-2-ylamino)propyl]piperazin-1-yl]propyl]propanamide |
|---|---|
| PubChem CID | 170603278 |
| Molecular Formula | C23H52N4O |
| Molecular Weight | 400.70 g/mol |
| Exact Mass | 400.41 |
| IUPAC Name | ethane;2-methyl-N-[3-[4-[3-(prop-1-en-2-ylamino)propyl]piperazin-1-yl]propyl]propanamide |
| SMILES | C=C(C)NCCCN1CCN(CCCNC(=O)C(C)C)CC1.CC.CC.CC |
| InChI | InChI=1S/C17H34N4O.3C2H6/c1-15(2)17(22)19-8-6-10-21-13-11-20(12-14-21)9-5-7-18-16(3)4;3*1-2/h15,18H,3,5-14H2,1-2,4H3,(H,19,22);3*1-2H3 |
| InChIKey | CUCBSZKMDAKXAN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.70 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|