About 1-[2-(1-ethyl-4,4-difluoropyrrolidin-3-yl)oxyethyl]piperidine;propane
1-[2-(1-ethyl-4,4-difluoropyrrolidin-3-yl)oxyethyl]piperidine;propane (PubChem CID 170606723) has the molecular formula C16H32F2N2O
and a molecular weight of 306.44 g/mol. Its IUPAC name is 1-[2-(1-ethyl-4,4-difluoropyrrolidin-3-yl)oxyethyl]piperidine;propane.
Molecular Properties
| Compound Name | 1-[2-(1-ethyl-4,4-difluoropyrrolidin-3-yl)oxyethyl]piperidine;propane |
| PubChem CID | 170606723 |
| Molecular Formula | C16H32F2N2O |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.25 |
| IUPAC Name | 1-[2-(1-ethyl-4,4-difluoropyrrolidin-3-yl)oxyethyl]piperidine;propane |
| SMILES | CCC.CCN1CC(OCCN2CCCCC2)C(F)(F)C1 |
| InChI | InChI=1S/C13H24F2N2O.C3H8/c1-2-16-10-12(13(14,15)11-16)18-9-8-17-6-4-3-5-7-17;1-3-2/h12H,2-11H2,1H3;3H2,1-2H3 |
| InChIKey | ZUSWCPUGGSWOPG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(1-ethyl-4,4-difluoropyrrolidin-3-yl)oxyethyl]piperidine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(1-ethyl-4,4-difluoropyrrolidin-3-yl)oxyethyl]piperidine;propane?
The IUPAC name of 1-[2-(1-ethyl-4,4-difluoropyrrolidin-3-yl)oxyethyl]piperidine;propane (CID 170606723) is 1-[2-(1-ethyl-4,4-difluoropyrrolidin-3-yl)oxyethyl]piperidine;propane.
What is the SMILES notation for 1-[2-(1-ethyl-4,4-difluoropyrrolidin-3-yl)oxyethyl]piperidine;propane?
The canonical SMILES for 1-[2-(1-ethyl-4,4-difluoropyrrolidin-3-yl)oxyethyl]piperidine;propane is CCC.CCN1CC(OCCN2CCCCC2)C(F)(F)C1.
What is the InChIKey of 1-[2-(1-ethyl-4,4-difluoropyrrolidin-3-yl)oxyethyl]piperidine;propane?
The InChIKey is ZUSWCPUGGSWOPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24F2N2O.C3H8/c1-2-16-10-12(13(14,15)11-16)18-9-8-17-6-4-3-5-7-17;1-3-2/h12H,2-11H2,1H3;3H2,1-2H3.
What are the key properties of 1-[2-(1-ethyl-4,4-difluoropyrrolidin-3-yl)oxyethyl]piperidine;propane?
1-[2-(1-ethyl-4,4-difluoropyrrolidin-3-yl)oxyethyl]piperidine;propane has a molecular weight of 306.44 g/mol, XLogP of 3.24, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(1-ethyl-4,4-difluoropyrrolidin-3-yl)oxyethyl]piperidine;propane is sourced from PubChem (CID 170606723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).