C18H31N7O2S — CID 170607425
N',4-dimethylpiperazine-1-carbohydrazide;ethane;N-(4-methoxy-1H-benzimidazol-2-yl)methanethioamide (PubChem CID 170607425) has the molecular formula C18H31N7O2S and a molecular weight of 409.56 g/mol. Its IUPAC name is N',4-dimethylpiperazine-1-carbohydrazide;ethane;N-(4-methoxy-1H-benzimidazol-2-yl)methanethioamide.
| Compound Name | N',4-dimethylpiperazine-1-carbohydrazide;ethane;N-(4-methoxy-1H-benzimidazol-2-yl)methanethioamide |
|---|---|
| PubChem CID | 170607425 |
| Molecular Formula | C18H31N7O2S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | N',4-dimethylpiperazine-1-carbohydrazide;ethane;N-(4-methoxy-1H-benzimidazol-2-yl)methanethioamide |
| SMILES | CC.CNNC(=O)N1CCN(C)CC1.COc1cccc2[nH]c(NC=S)nc12 |
| InChI | InChI=1S/C9H9N3OS.C7H16N4O.C2H6/c1-13-7-4-2-3-6-8(7)12-9(11-6)10-5-14;1-8-9-7(12)11-5-3-10(2)4-6-11;1-2/h2-5H,1H3,(H2,10,11,12,14);8H,3-6H2,1-2H3,(H,9,12);1-2H3 |
| InChIKey | VADQUVYHGLXGHU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|