C18H19N5O4S — CID 170607439
1-[(3,4-dimethoxybenzoyl)amino]-3-(4-methoxy-1H-benzimidazol-2-yl)thiourea (PubChem CID 170607439) has the molecular formula C18H19N5O4S and a molecular weight of 401.45 g/mol. Its IUPAC name is 1-[(3,4-dimethoxybenzoyl)amino]-3-(4-methoxy-1H-benzimidazol-2-yl)thiourea.
| Compound Name | 1-[(3,4-dimethoxybenzoyl)amino]-3-(4-methoxy-1H-benzimidazol-2-yl)thiourea |
|---|---|
| PubChem CID | 170607439 |
| Molecular Formula | C18H19N5O4S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 1-[(3,4-dimethoxybenzoyl)amino]-3-(4-methoxy-1H-benzimidazol-2-yl)thiourea |
| SMILES | COc1ccc(C(=O)NNC(=S)Nc2nc3c(OC)cccc3[nH]2)cc1OC |
| InChI | InChI=1S/C18H19N5O4S/c1-25-12-8-7-10(9-14(12)27-3)16(24)22-23-18(28)21-17-19-11-5-4-6-13(26-2)15(11)20-17/h4-9H,1-3H3,(H,22,24)(H3,19,20,21,23,28) |
| InChIKey | PFNQZQFPHFPNOY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 109.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|