C25H20N4O9S — CID 17060896
1-O-ethyl 6-O-methyl (8E)-7-amino-3-(3-nitrophenyl)-8-[(3-nitrophenyl)methylidene]-4-oxopyrrolo[2,1-c][1,4]thiazine-1,6-dicarboxylate (PubChem CID 17060896) has the molecular formula C25H20N4O9S and a molecular weight of 552.52 g/mol. Its IUPAC name is 1-O-ethyl 6-O-methyl (8E)-7-amino-3-(3-nitrophenyl)-8-[(3-nitrophenyl)methylidene]-4-oxopyrrolo[2,1-c][1,4]thiazine-1,6-dicarboxylate.
| Compound Name | 1-O-ethyl 6-O-methyl (8E)-7-amino-3-(3-nitrophenyl)-8-[(3-nitrophenyl)methylidene]-4-oxopyrrolo[2,1-c][1,4]thiazine-1,6-dicarboxylate |
|---|---|
| PubChem CID | 17060896 |
| Molecular Formula | C25H20N4O9S |
| Molecular Weight | 552.52 g/mol |
| Exact Mass | 552.10 |
| IUPAC Name | 1-O-ethyl 6-O-methyl (8E)-7-amino-3-(3-nitrophenyl)-8-[(3-nitrophenyl)methylidene]-4-oxopyrrolo[2,1-c][1,4]thiazine-1,6-dicarboxylate |
| SMILES | CCOC(=O)C1=c2/c(=C/c3cccc([N+](=O)[O-])c3)c(N)c(C(=O)OC)n2C(=O)C(c2cccc([N+](=O)[O-])c2)S1 |
| InChI | InChI=1S/C25H20N4O9S/c1-3-38-25(32)22-19-17(11-13-6-4-8-15(10-13)28(33)34)18(26)20(24(31)37-2)27(19)23(30)21(39-22)14-7-5-9-16(12-14)29(35)36/h4-12,21H,3,26H2,1-2H3/b17-11+ |
| InChIKey | YADVKWHEFZKDML-GZTJUZNOSA-N |
| XLogP | 2.30 |
| TPSA | 186.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.52 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|